Products 1162257-29-5
CAS 1162257-29-5 appears in our catalog under these names: 2-Propoxy-5-(trifluoromethyl)phenylboronic acid, 98%, 2-Propoxy-5-(trifluoromethyl)phenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 25g, 1g.
[2-propoxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 1162257-29-5) is a chemical compound with the molecular formula C10H12BF3O3 and a molecular weight of 248.01 g/mol. IUPAC name: [2-propoxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: PVXWTWSMVNMSTE-UHFFFAOYSA-N.
| Molecular formula | C10H12BF3O3 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | [2-propoxy-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | PVXWTWSMVNMSTE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)OCCC)(O)O |
Computed by PubChem (NCBI)