CAS 2096341-53-4 appears in our catalog under these names: 3-Isopropoxy-4-(trifluoromethyl)phenylboronic acid, 96%, 3-Isopropoxy-4-(trifluoromethyl)phenylboronic acid, 98%, (3-Isopropoxy-4-(trifluoromethyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
[3-propan-2-yloxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 2096341-53-4) is a chemical compound with the molecular formula C10H12BF3O3 and a molecular weight of 248.01 g/mol. IUPAC name: [3-propan-2-yloxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: XSWWHVQQUGGXQP-UHFFFAOYSA-N.
| Molecular formula | C10H12BF3O3 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | [3-propan-2-yloxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | XSWWHVQQUGGXQP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)OC(C)C)(O)O |
Computed by PubChem (NCBI)