CAS 1444260-43-8 appears in our catalog under these names: 4-Isopropoxy-3-(trifluoromethyl)benzeneboronic acid, 95%, (4–Isopropoxy–3–(trifluoromethyl)phenyl)boronic acid, B-[4-(1-Methylethoxy)-3-(trifluoromethyl)phenyl]boronic acid, 95%+, 95%+, 4-Isopropoxy-3-(trifluoromethyl)phenylboronic acid. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
[4-propan-2-yloxy-3-(trifluoromethyl)phenyl]boronic acid (CAS 1444260-43-8) is a chemical compound with the molecular formula C10H12BF3O3 and a molecular weight of 248.01 g/mol. IUPAC name: [4-propan-2-yloxy-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: BJUWYZGRAZSRQW-UHFFFAOYSA-N.
| Molecular formula | C10H12BF3O3 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | [4-propan-2-yloxy-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | BJUWYZGRAZSRQW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(C)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)