(4-Phenylnaphthalen-1-yl)boronic acid, 97%
cas: 372521-91-0 — see every product listed under this CAS number, including other names
(4-Phenylnaphthalen-1-yl)boronic acid, 97% (CAS 372521-91-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A125944-1g |
| cas | 372521-91-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1338.25 Pln | |
| Ambeed | 500g | 5148.56 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 292.14 Pln | |
| BLDpharm | 25g | 442.09 Pln | |
| BLDpharm | 100g | 1441.74 Pln | |
| BLDpharm | 500g | 5545.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-phenylnaphthalen-1-yl)boronic acid (CAS 372521-91-0) is a chemical compound with the molecular formula C16H13BO2 and a molecular weight of 248.1 g/mol. IUPAC name: (4-phenylnaphthalen-1-yl)boronic acid. InChIKey: BSKLSKWOKGVQHF-UHFFFAOYSA-N.
| Molecular formula | C16H13BO2 |
|---|---|
| Molecular weight | 248.1 g/mol |
| IUPAC name | (4-phenylnaphthalen-1-yl)boronic acid |
| InChIKey | BSKLSKWOKGVQHF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C12)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-phenylnaphthalene-1-boronic acid, (4-Phenylnaphthalen-1-yl)boronic acid, 4-phenylnaphthalen-1-ylboronic acid, 4-phenyl(naphthalene-1-yl)boronic acid, (4-Phenylnaphthalen-1-yl);boronic acid, (4-Phenylnaphthalen-1-yl)boronicacid, (4-phenyl-1-naphthyl)boronic acid, 1-phenylnaphthalene-4-boronic acid, 4-Phenylnaphthalene-1-boronic Acid (contains varying amounts of Anhydride)