cas: 90916-45-3 — see every product listed under this CAS number, including other names
(4-Phenylthiazol-2-yl)methanamine 95% (CAS 90916-45-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A866167-100mg |
| cas | 90916-45-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2167.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A866167 |
(4-phenyl-1,3-thiazol-2-yl)methanamine (CAS 90916-45-3) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: (4-phenyl-1,3-thiazol-2-yl)methanamine. InChIKey: AFSCUDNEJWEMEA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | (4-phenyl-1,3-thiazol-2-yl)methanamine |
| InChIKey | AFSCUDNEJWEMEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CN |
Computed by PubChem (NCBI)