(41S,7aS,13aR,13bR)-2,3,41,6,7,7a,8,13,13a,13b-Decahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one hydrate, 98%, 98%
cas: 145572-44-7 — see every product listed under this CAS number, including other names
(41S,7aS,13aR,13bR)-2,3,41,6,7,7a,8,13,13a,13b-Decahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one hydrate, 98%, 98% (CAS 145572-44-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112D7W-100mg |
| cas | 145572-44-7 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 669.20 Pln | |
| Chemat | 25g | 3088.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate (CAS 145572-44-7) is a chemical compound with the molecular formula C15H24N2O2 and a molecular weight of 264.36 g/mol. IUPAC name: (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate. InChIKey: FBOREIYHDGYUFA-PUILLJIJSA-N.
| Molecular formula | C15H24N2O2 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate |
| InChIKey | FBOREIYHDGYUFA-PUILLJIJSA-N |
| SMILES | C1C[C@H]2CN3[C@H](CC=CC3=O)[C@@H]4[C@H]2N(C1)CCC4.O |
Computed by PubChem (NCBI)