Sophocarpine monohydrate 98%
cas: 145572-44-7 — see every product listed under this CAS number, including other names
Sophocarpine monohydrate 98% (CAS 145572-44-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A586664-10mg |
| cas | 145572-44-7 |
| size | 10mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 186.81 Pln | |
| Ambeed | 50mg | 209.06 Pln | |
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 2050.25 Pln | |
| Ambeed | 25g | 6010.75 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A586664 |
(1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate (CAS 145572-44-7) is a chemical compound with the molecular formula C15H24N2O2 and a molecular weight of 264.36 g/mol. IUPAC name: (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate. InChIKey: FBOREIYHDGYUFA-PUILLJIJSA-N.
| Molecular formula | C15H24N2O2 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate |
| InChIKey | FBOREIYHDGYUFA-PUILLJIJSA-N |
| SMILES | C1C[C@H]2CN3[C@H](CC=CC3=O)[C@@H]4[C@H]2N(C1)CCC4.O |
Computed by PubChem (NCBI)