cas: 143527-70-2 — see every product listed under this CAS number, including other names
(4S,5R)-3-Boc-2,2-DiMe-4-Ph-oxazolidine-5-carboxylic acid 95% (CAS 143527-70-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108901-250mg |
| cas | 143527-70-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 576.19 Pln | |
| Ambeed | 10g | 1060.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108901 |
(4S,5R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenyl-1,3-oxazolidine-5-carboxylic acid (CAS 143527-70-2) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: (4S,5R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenyl-1,3-oxazolidine-5-carboxylic acid. InChIKey: VAHXMEZCPGHDBJ-QWHCGFSZSA-N.
| Molecular formula | C17H23NO5 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (4S,5R)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenyl-1,3-oxazolidine-5-carboxylic acid |
| InChIKey | VAHXMEZCPGHDBJ-QWHCGFSZSA-N |
| SMILES | CC1(N([C@H]([C@@H](O1)C(=O)O)C2=CC=CC=C2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)