CAS 350820-56-3 appears in our catalog under these names: Boc-D-Tyr(Allyl)-OH, 95%, Boc-D-Tyr(All)-OH, 98%, R)–3–(4–(allyloxy)phenyl)–2–((tert–butoxycarbonyl)amino)propanoic acid, Boc-D-Tyr(All)-OH. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech. Available pack sizes: 1g, 25g, 5g, 100mg.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-prop-2-enoxyphenyl)propanoic acid (CAS 350820-56-3) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-prop-2-enoxyphenyl)propanoic acid. InChIKey: YIRRNENSHUFZBH-CQSZACIVSA-N.
| Molecular formula | C17H23NO5 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-prop-2-enoxyphenyl)propanoic acid |
| InChIKey | YIRRNENSHUFZBH-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)OCC=C)C(=O)O |
Computed by PubChem (NCBI)