CAS 1217689-78-5 is the registry number for Boc-(+/-)-trans-4-(2-methoxy-phenyl)-pyrrolidine-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
(3R,4S)-4-(2-methoxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1217689-78-5) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: (3R,4S)-4-(2-methoxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: HMAXDKCSXKNKKD-OLZOCXBDSA-N.
| Molecular formula | C17H23NO5 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (3R,4S)-4-(2-methoxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | HMAXDKCSXKNKKD-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CC=CC=C2OC |
Computed by PubChem (NCBI)