CAS 127132-38-1 appears in our catalog under these names: Boc-L-Tyr(Allyl)-OH, 97%, (S)–3–(4–(Allyloxy)phenyl)–2–((tert–butoxycarbonyl)amino)propanoic acid, Boc-L-Tyr(All)-OH, BOC-TYR(ALLYL)-OH, >=98.0%, (S)-3-(4-(Allyloxy)phenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 100mg, 250mg, 10g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-prop-2-enoxyphenyl)propanoic acid (CAS 127132-38-1) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-prop-2-enoxyphenyl)propanoic acid. InChIKey: YIRRNENSHUFZBH-AWEZNQCLSA-N.
| Molecular formula | C17H23NO5 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-prop-2-enoxyphenyl)propanoic acid |
| InChIKey | YIRRNENSHUFZBH-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OCC=C)C(=O)O |
Computed by PubChem (NCBI)