cas: 1229428-51-6 — see every product listed under this CAS number, including other names
(4aS,7aS)-tert-Butyl hexahydro-1H-pyrrolo[3,4-b]pyridine-6(2H)-carboxylate, 95%, 95% (CAS 1229428-51-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HH6M-1g |
| cas | 1229428-51-6 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2690.00 Pln | |
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1360.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate (CAS 1229428-51-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate. InChIKey: LPNOEYLQBVUWGH-VHSXEESVSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate |
| InChIKey | LPNOEYLQBVUWGH-VHSXEESVSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCCN[C@@H]2C1 |
Computed by PubChem (NCBI)