cas: 1229428-51-6 — see every product listed under this CAS number, including other names
tert-Butyl (4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridine-6-carboxylate, 95% (CAS 1229428-51-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F556485-100MG |
| cas | 1229428-51-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1096.51 Pln | |
| Fluorochem | 250mg | 1716.08 Pln | |
| Fluorochem | 1g | 3402.99 Pln | |
| Fluorochem | 5g | 9796.57 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate (CAS 1229428-51-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate. InChIKey: LPNOEYLQBVUWGH-VHSXEESVSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate |
| InChIKey | LPNOEYLQBVUWGH-VHSXEESVSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCCN[C@@H]2C1 |
Computed by PubChem (NCBI)