cas: 159991-07-8 — see every product listed under this CAS number, including other names
(4aS,7aS)-tert-Butyl octahydro-1H-pyrrolo[3,4-b]pyridine-1-carboxylate, 97%, 97% (CAS 159991-07-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RKW-100mg |
| cas | 159991-07-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 616.40 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 500mg | 1307.60 Pln | |
| Chemat | 1g | 2181.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate (CAS 159991-07-8) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate. InChIKey: LGEWGFOMLJQHLL-VHSXEESVSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate |
| InChIKey | LGEWGFOMLJQHLL-VHSXEESVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]2[C@H]1CNC2 |
Computed by PubChem (NCBI)