cas: 1346526-61-1 — see every product listed under this CAS number, including other names
(5,6-Dimethoxypyridin-3-yl)boronic acid 95% (CAS 1346526-61-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A467007-250mg |
| cas | 1346526-61-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 3841.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A467007 |
(5,6-dimethoxy-3-pyridinyl)boronic acid (CAS 1346526-61-1) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: (5,6-dimethoxy-3-pyridinyl)boronic acid. InChIKey: WIFHLSYUKVVFMK-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4 |
|---|---|
| Molecular weight | 182.97 g/mol |
| IUPAC name | (5,6-dimethoxy-3-pyridinyl)boronic acid |
| InChIKey | WIFHLSYUKVVFMK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)OC)OC)(O)O |
Computed by PubChem (NCBI)