cas: 1190423-61-0 — see every product listed under this CAS number, including other names
(5-(Benzyloxy)pyridin-3-yl)boronic acid, 95% (CAS 1190423-61-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692485-5G |
| cas | 1190423-61-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1799.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(5-phenylmethoxy-3-pyridinyl)boronic acid (CAS 1190423-61-0) is a chemical compound with the molecular formula C12H12BNO3 and a molecular weight of 229.04 g/mol. IUPAC name: (5-phenylmethoxy-3-pyridinyl)boronic acid. InChIKey: IGKYPUBWQHKLLC-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO3 |
|---|---|
| Molecular weight | 229.04 g/mol |
| IUPAC name | (5-phenylmethoxy-3-pyridinyl)boronic acid |
| InChIKey | IGKYPUBWQHKLLC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)