CAS 1072952-41-0 appears in our catalog under these names: 2-Benzyloxypyridine-3-boronic acid, 97%, (2-(Benzyloxy)pyridin-3-yl)boronic acid, 98%, 98%, (2-(Benzyloxy)pyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2-phenylmethoxy-3-pyridinyl)boronic acid (CAS 1072952-41-0) is a chemical compound with the molecular formula C12H12BNO3 and a molecular weight of 229.04 g/mol. IUPAC name: (2-phenylmethoxy-3-pyridinyl)boronic acid. InChIKey: YTIGWZQYGHOXOB-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO3 |
|---|---|
| Molecular weight | 229.04 g/mol |
| IUPAC name | (2-phenylmethoxy-3-pyridinyl)boronic acid |
| InChIKey | YTIGWZQYGHOXOB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)