CAS 196861-33-3 appears in our catalog under these names: 2-Methoxy-5-(pyridine-4-yl)phenylboronic acid, 95%, 2-Methoxy-5-(pyridin-4-yl)phenylboronic acid, 95-<97%, 2-Methoxy-5-(pyridin-4-yl)phenylboronic acid, ≥97-<99%, (2-Methoxy-5-(pyridin-4-yl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g, 10g, 25g.
(2-methoxy-5-pyridin-4-ylphenyl)boronic acid (CAS 196861-33-3) is a chemical compound with the molecular formula C12H12BNO3 and a molecular weight of 229.04 g/mol. IUPAC name: (2-methoxy-5-pyridin-4-ylphenyl)boronic acid. InChIKey: QLNYKODXAPVKKX-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO3 |
|---|---|
| Molecular weight | 229.04 g/mol |
| IUPAC name | (2-methoxy-5-pyridin-4-ylphenyl)boronic acid |
| InChIKey | QLNYKODXAPVKKX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2=CC=NC=C2)OC)(O)O |
Computed by PubChem (NCBI)