Products 1219737-09-3
CAS 1219737-09-3 appears in our catalog under these names: 5-(4-Methoxyphenyl)pyridin-3-ylboronic acid, 95%, (5-(4-Methoxyphenyl)pyridin-3-yl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g.
[5-(4-methoxyphenyl)-3-pyridinyl]boronic acid (CAS 1219737-09-3) is a chemical compound with the molecular formula C12H12BNO3 and a molecular weight of 229.04 g/mol. IUPAC name: [5-(4-methoxyphenyl)-3-pyridinyl]boronic acid. InChIKey: PNDVWBIURRJWIL-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO3 |
|---|---|
| Molecular weight | 229.04 g/mol |
| IUPAC name | [5-(4-methoxyphenyl)-3-pyridinyl]boronic acid |
| InChIKey | PNDVWBIURRJWIL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)C2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)