(5-Acetylpyridin-3-yl)boronic acid, 95%
cas: 1033745-21-9 — see every product listed under this CAS number, including other names
(5-Acetylpyridin-3-yl)boronic acid, 95% (CAS 1033745-21-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | FA-1793-250mg |
| cas | 1033745-21-9 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 626.25 Pln | |
| Ambeed | 5g | 2450.75 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 794.00 Pln | |
| Chemat | 5g | 2627.60 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 669.79 Pln | |
| BLDpharm | 5g | 2635.76 Pln | |
| Fluorochem | 100mg | 398.84 Pln | |
| Fluorochem | 250mg | 617.51 Pln | |
| Fluorochem | 1g | 1466.17 Pln | |
| Fluorochem | 5g | 4871.22 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(5-acetyl-3-pyridinyl)boronic acid (CAS 1033745-21-9) is a chemical compound with the molecular formula C7H8BNO3 and a molecular weight of 164.96 g/mol. IUPAC name: (5-acetyl-3-pyridinyl)boronic acid. InChIKey: MJFGIOXMWMNLOK-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO3 |
|---|---|
| Molecular weight | 164.96 g/mol |
| IUPAC name | (5-acetyl-3-pyridinyl)boronic acid |
| InChIKey | MJFGIOXMWMNLOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)C(=O)C)(O)O |
Computed by PubChem (NCBI)