Products 2682066-26-6

CAS 2682066-26-6 is the registry number for (6-Acetylpyridin-3-yl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(6-acetyl-3-pyridinyl)boronic acid (CAS 2682066-26-6) is a chemical compound with the molecular formula C7H8BNO3 and a molecular weight of 164.96 g/mol. IUPAC name: (6-acetyl-3-pyridinyl)boronic acid. InChIKey: UWZJNMVLRSEKHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BNO3
Molecular weight164.96 g/mol
IUPAC name(6-acetyl-3-pyridinyl)boronic acid
InChIKeyUWZJNMVLRSEKHZ-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)C(=O)C)(O)O

Computed by PubChem (NCBI)