cas: 2096337-64-1 — see every product listed under this CAS number, including other names
(5-Bromo-2,3-difluoro-4-methoxyphenyl)boronic acid 97% (CAS 2096337-64-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A794679-250mg |
| cas | 2096337-64-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A794679 |
(5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid (CAS 2096337-64-1) is a chemical compound with the molecular formula C7H6BBrF2O3 and a molecular weight of 266.83 g/mol. IUPAC name: (5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid. InChIKey: QWHLPUWLRAUTMV-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrF2O3 |
|---|---|
| Molecular weight | 266.83 g/mol |
| IUPAC name | (5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | QWHLPUWLRAUTMV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)OC)Br)(O)O |
Computed by PubChem (NCBI)