cas: 2096337-64-1 — see every product listed under this CAS number, including other names
5-Bromo-2,3-difluoro-4-methoxyphenylboronic acid, 97% (CAS 2096337-64-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622916-250MG |
| cas | 2096337-64-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 1g | 1205.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid (CAS 2096337-64-1) is a chemical compound with the molecular formula C7H6BBrF2O3 and a molecular weight of 266.83 g/mol. IUPAC name: (5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid. InChIKey: QWHLPUWLRAUTMV-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrF2O3 |
|---|---|
| Molecular weight | 266.83 g/mol |
| IUPAC name | (5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | QWHLPUWLRAUTMV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)OC)Br)(O)O |
Computed by PubChem (NCBI)