cas: 1451392-88-3 — see every product listed under this CAS number, including other names
(5-Bromobenzo(d)(1,3)dioxol-4-yl)boronic acid, 98% (CAS 1451392-88-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A564139-25g |
| cas | 1451392-88-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 6586.51 Pln | |
| AmBeed | 250mg | 629.86 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(5-bromo-1,3-benzodioxol-4-yl)boronic acid (CAS 1451392-88-3) is a chemical compound with the molecular formula C7H6BBrO4 and a molecular weight of 244.84 g/mol. IUPAC name: (5-bromo-1,3-benzodioxol-4-yl)boronic acid. InChIKey: QYRRTVQPTCHAGY-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO4 |
|---|---|
| Molecular weight | 244.84 g/mol |
| IUPAC name | (5-bromo-1,3-benzodioxol-4-yl)boronic acid |
| InChIKey | QYRRTVQPTCHAGY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=C1OCO2)Br)(O)O |
Computed by PubChem (NCBI)