Products 913835-73-1
CAS 913835-73-1 appears in our catalog under these names: 3-Borono-5-bromobenzoic acid, 97%, 3-Borono-5-bromobenzoic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 5g, 10g, 25g, 1g.
3-borono-5-bromobenzoic acid (CAS 913835-73-1) is a chemical compound with the molecular formula C7H6BBrO4 and a molecular weight of 244.84 g/mol. IUPAC name: 3-borono-5-bromobenzoic acid. InChIKey: CWBLIPMCDMSOFX-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO4 |
|---|---|
| Molecular weight | 244.84 g/mol |
| IUPAC name | 3-borono-5-bromobenzoic acid |
| InChIKey | CWBLIPMCDMSOFX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C(=O)O)(O)O |
Computed by PubChem (NCBI)