cas: 2087452-50-2 — see every product listed under this CAS number, including other names
(5-Chlorobenzo[d][1,3]dioxol-4-yl)boronicacid 98% (CAS 2087452-50-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A801103-100mg |
| cas | 2087452-50-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A801103 |
(5-chloro-1,3-benzodioxol-4-yl)boronic acid (CAS 2087452-50-2) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: (5-chloro-1,3-benzodioxol-4-yl)boronic acid. InChIKey: OJUBGVPJUUYQRE-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | (5-chloro-1,3-benzodioxol-4-yl)boronic acid |
| InChIKey | OJUBGVPJUUYQRE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=C1OCO2)Cl)(O)O |
Computed by PubChem (NCBI)