CAS 874290-67-2 appears in our catalog under these names: 2-Carboxy-5-chlorophenylboronic acid, 97%, 2-Borono-4-chlorobenzoic acid 98%, 2-Borono-4-chlorobenzoic acid, 98%, 2-Borono-4-chlorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-borono-4-chlorobenzoic acid (CAS 874290-67-2) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 2-borono-4-chlorobenzoic acid. InChIKey: OTIPTCHUAWBCTA-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 2-borono-4-chlorobenzoic acid |
| InChIKey | OTIPTCHUAWBCTA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C(=O)O)(O)O |
Computed by PubChem (NCBI)