cas: 2087452-50-2 — see every product listed under this CAS number, including other names
(5-Chlorobenzo[d][1,3]dioxol-4-yl)boronic acid, 97% (CAS 2087452-50-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F788106-100MG |
| cas | 2087452-50-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 914.28 Pln | |
| Fluorochem | 5g | 2913.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(5-chloro-1,3-benzodioxol-4-yl)boronic acid (CAS 2087452-50-2) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: (5-chloro-1,3-benzodioxol-4-yl)boronic acid. InChIKey: OJUBGVPJUUYQRE-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | (5-chloro-1,3-benzodioxol-4-yl)boronic acid |
| InChIKey | OJUBGVPJUUYQRE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=C1OCO2)Cl)(O)O |
Computed by PubChem (NCBI)