CAS 850568-07-9 appears in our catalog under these names: 2-Carboxy-4-chlorophenylboronic acid, 98%, 2-Borono-5-chlorobenzoic acid, 98%, 2-Borono-5-chlorobenzoic acid 95%, Benzoic acid, 2-borono-5-chloro-, 95%, 95%, 2-Borono-5-chlorobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100mg, 250mg.
2-borono-5-chlorobenzoic acid (CAS 850568-07-9) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 2-borono-5-chlorobenzoic acid. InChIKey: RENDEFHQQIYNJL-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 2-borono-5-chlorobenzoic acid |
| InChIKey | RENDEFHQQIYNJL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)C(=O)O)(O)O |
Computed by PubChem (NCBI)