cas: 885271-93-2 — see every product listed under this CAS number, including other names
(5-Fluoro-1h-indazol-3-yl)-acetic acid ethyl ester, 96%, 96% (CAS 885271-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IF66-100mg |
| cas | 885271-93-2 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(5-fluoro-2H-indazol-3-yl)acetate (CAS 885271-93-2) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: ethyl 2-(5-fluoro-2H-indazol-3-yl)acetate. InChIKey: RLQKHYIJSNFESC-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | ethyl 2-(5-fluoro-2H-indazol-3-yl)acetate |
| InChIKey | RLQKHYIJSNFESC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C2C=C(C=CC2=NN1)F |
Computed by PubChem (NCBI)