CAS 878730-38-2 is the registry number for 1-(4-Fluorophenyl)-5-oxopyrrolidine-3-carboxamide, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (CAS 878730-38-2) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide. InChIKey: UAMJCKIPGGIJKE-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| InChIKey | UAMJCKIPGGIJKE-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=C(C=C2)F)C(=O)N |
Computed by PubChem (NCBI)