CAS 25631-05-4 appears in our catalog under these names: 4-Fluoro-DL-tryptophan, 4-Fluoro-dl-tryptophan, 95%, H-DL-Trp(4-F)-OH 97%, 2–Amino–3–(4–fluoro–1H–indol–3–yl)propanoic acid, 2-Amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid, ≥98%, ≥98%. Offered by: Fluorochem, Combi-blocks, Ambeed, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 25mg.
2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid (CAS 25631-05-4) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: 2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: DEBQMEYEKKWIKC-UHFFFAOYSA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | 2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | DEBQMEYEKKWIKC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)