CAS 97749-24-1 appears in our catalog under these names: 5-Fluoro-d-tryptophan, 95%, 5-Fluoro-D-Tryptophan, D-5-Fluorotryptophan, 97%, 97%, 5-Fluoro-D-tryptophan, 97%, H-D-Trp(5-F)-OH, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 0,5g, 2,5g, 10g.
(2R)-2-amino-3-(5-fluoro-1H-indol-3-yl)propanoic acid (CAS 97749-24-1) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: (2R)-2-amino-3-(5-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: INPQIVHQSQUEAJ-SECBINFHSA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | (2R)-2-amino-3-(5-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | INPQIVHQSQUEAJ-SECBINFHSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)