Products 2711325-28-7

CAS 2711325-28-7 is the registry number for (5R)-7-oxa-2-azaspiro[4.5]decane1/2oxalicacid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Bis((5R)-7-oxa-2-azaspiro[4.5]decane);oxalic acid (CAS 2711325-28-7) is a chemical compound with the molecular formula C18H32N2O6 and a molecular weight of 372.5 g/mol. IUPAC name: bis((5R)-7-oxa-2-azaspiro[4.5]decane);oxalic acid. InChIKey: GHDPJNVTRYZODS-GGTCEIRZSA-N.

Identity
Molecular formulaC18H32N2O6
Molecular weight372.5 g/mol
IUPAC namebis((5R)-7-oxa-2-azaspiro[4.5]decane);oxalic acid
InChIKeyGHDPJNVTRYZODS-GGTCEIRZSA-N
SMILESC1C[C@]2(CCNC2)COC1.C1C[C@]2(CCNC2)COC1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)