(5S,6R,7S,8R)-5,6,7,8-Tetrahydroxy-2-phenethyl-5,6,7,8-tetrahydro-4H-chromen-4-one
cas: 104060-61-9 — see every product listed under this CAS number, including other names
(5S,6R,7S,8R)-5,6,7,8-Tetrahydroxy-2-phenethyl-5,6,7,8-tetrahydro-4H-chromen-4-one (CAS 104060-61-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 20mg, 50mg, 100mg, 200mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12N4QJ-1mg |
| cas | 104060-61-9 |
| size | 1mg |
| availability | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 323.60 Pln | |
| Chemat | 5mg | 693.20 Pln | |
| Chemat | 10mg | 995.60 Pln | |
| Chemat | 20mg | 1250.00 Pln | |
| Chemat | 50mg | 2430.80 Pln | |
| Chemat | 100mg | 4053.20 Pln | |
| Chemat | 200mg | 6712.40 Pln | |
| Chemat | 500mg | 13360.40 Pln | |
| Chemat | 1g | 22221.20 Pln |
properties
| delivery time | 3 weeks |
|---|
(5S,6R,7S,8R)-5,6,7,8-tetrahydroxy-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-4-one (CAS 104060-61-9) is a chemical compound with the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. IUPAC name: (5S,6R,7S,8R)-5,6,7,8-tetrahydroxy-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-4-one. InChIKey: CWMIROLCTHMEEO-XUWVNRHRSA-N.
| Molecular formula | C17H18O6 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | (5S,6R,7S,8R)-5,6,7,8-tetrahydroxy-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-4-one |
| InChIKey | CWMIROLCTHMEEO-XUWVNRHRSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC(=O)C3=C(O2)[C@@H]([C@H]([C@@H]([C@H]3O)O)O)O |
Computed by PubChem (NCBI)