CAS 3680-32-8 appears in our catalog under these names: (1'S,6'R)-2',4,6-Trimethoxy-6'-methyl-3H-spiro[benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione, 95+%, Griseofulvin EP Impurity B (Dechloro Griseofulvin), 7-Dechloro Griseofulvin, 7-Dechloro Griseofulvin, >95% (HPLC), 7–dechloro Griseofulvin. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 25mg, 10 mg, 25 mg, 1 mg.
(2S,5'R)-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione (CAS 3680-32-8) is a chemical compound with the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. IUPAC name: (2S,5'R)-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione. InChIKey: QPCYNIYZPDJCMB-XLFHBGCDSA-N.
| Molecular formula | C17H18O6 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | (2S,5'R)-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
| InChIKey | QPCYNIYZPDJCMB-XLFHBGCDSA-N |
| SMILES | C[C@@H]1CC(=O)C=C([C@]12C(=O)C3=C(O2)C=C(C=C3OC)OC)OC |
Computed by PubChem (NCBI)