Products 1404479-45-3
CAS 1404479-45-3 appears in our catalog under these names: Aquilarone B, Aquilarone B, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 1 mg, 5mg, 10mg, 20mg, 50mg.
(5S,6S,7S,8R)-5,6,7,8-tetrahydroxy-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-4-one (CAS 1404479-45-3) is a chemical compound with the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. IUPAC name: (5S,6S,7S,8R)-5,6,7,8-tetrahydroxy-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-4-one. InChIKey: CWMIROLCTHMEEO-YHUYYLMFSA-N.
| Molecular formula | C17H18O6 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | (5S,6S,7S,8R)-5,6,7,8-tetrahydroxy-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-4-one |
| InChIKey | CWMIROLCTHMEEO-YHUYYLMFSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC(=O)C3=C(O2)[C@@H]([C@H]([C@H]([C@H]3O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Aquilarone B, orb1941790