CAS 2873410-69-4 is the registry number for Dimethyl 2-(2-(methoxycarbonyl)phenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2-(2-methoxycarbonylphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylate (CAS 2873410-69-4) is a chemical compound with the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. IUPAC name: dimethyl 2-(2-methoxycarbonylphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylate. InChIKey: MZUFDQVNIYYPOT-UHFFFAOYSA-N.
| Molecular formula | C17H18O6 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | dimethyl 2-(2-methoxycarbonylphenyl)bicyclo[1.1.1]pentane-1,3-dicarboxylate |
| InChIKey | MZUFDQVNIYYPOT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1C2C3(CC2(C3)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)