CAS 871126-17-9 appears in our catalog under these names: 6-Bromo-2-fluoro-3-methoxyphenylboronic acid, 98%, (6-Bromo-2-fluoro-3-methoxyphenyl)boronic acid, 98%, 2-Fluoro-3-methoxy-6-bromophenylboronic acid, 98%, 98%, (6-Bromo-2-fluoro-3-methoxyphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
(6-bromo-2-fluoro-3-methoxyphenyl)boronic acid (CAS 871126-17-9) is a chemical compound with the molecular formula C7H7BBrFO3 and a molecular weight of 248.84 g/mol. IUPAC name: (6-bromo-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: NUWSIUDCKHWOJN-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO3 |
|---|---|
| Molecular weight | 248.84 g/mol |
| IUPAC name | (6-bromo-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | NUWSIUDCKHWOJN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC)Br)(O)O |
Computed by PubChem (NCBI)