cas: 910649-58-0 — see every product listed under this CAS number, including other names
(6-Bromo-2-fluoropyridin-3-yl)boronic acid, 98% (CAS 910649-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233084-100MG |
| cas | 910649-58-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1559.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(6-bromo-2-fluoro-3-pyridinyl)boronic acid (CAS 910649-58-0) is a chemical compound with the molecular formula C5H4BBrFNO2 and a molecular weight of 219.81 g/mol. IUPAC name: (6-bromo-2-fluoro-3-pyridinyl)boronic acid. InChIKey: YUGZMJMNGRGYRZ-UHFFFAOYSA-N.
| Molecular formula | C5H4BBrFNO2 |
|---|---|
| Molecular weight | 219.81 g/mol |
| IUPAC name | (6-bromo-2-fluoro-3-pyridinyl)boronic acid |
| InChIKey | YUGZMJMNGRGYRZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Br)F)(O)O |
Computed by PubChem (NCBI)