cas: 1072946-50-9 — see every product listed under this CAS number, including other names
(6-Chloro-2-methoxypyridin-3-yl)boronic acid 96% (CAS 1072946-50-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A585340-250mg |
| cas | 1072946-50-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 10g | 793.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A585340 |
(6-chloro-2-methoxy-3-pyridinyl)boronic acid (CAS 1072946-50-9) is a chemical compound with the molecular formula C6H7BClNO3 and a molecular weight of 187.39 g/mol. IUPAC name: (6-chloro-2-methoxy-3-pyridinyl)boronic acid. InChIKey: QMTFZVCHSRMZJW-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO3 |
|---|---|
| Molecular weight | 187.39 g/mol |
| IUPAC name | (6-chloro-2-methoxy-3-pyridinyl)boronic acid |
| InChIKey | QMTFZVCHSRMZJW-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Cl)OC)(O)O |
Computed by PubChem (NCBI)