cas: 1217500-87-2 — see every product listed under this CAS number, including other names
(6-Chloro-4-(trifluoromethyl)pyridin-3-yl)boronic acid, 96% (CAS 1217500-87-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A104779-10g |
| cas | 1217500-87-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 27906.76 Pln | |
| AmBeed | 100mg | 1456.63 Pln | |
| AmBeed | 5g | 16768.15 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
[6-chloro-4-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1217500-87-2) is a chemical compound with the molecular formula C6H4BClF3NO2 and a molecular weight of 225.36 g/mol. IUPAC name: [6-chloro-4-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: YALGIBOIRBBJRU-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF3NO2 |
|---|---|
| Molecular weight | 225.36 g/mol |
| IUPAC name | [6-chloro-4-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | YALGIBOIRBBJRU-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1C(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)