CAS 536693-96-6 appears in our catalog under these names: 2-Chloro-5-(trifluoromethyl)pyridine-3-boronic acid, 95%, 2-Chloro-5-(trifluoromethyl)pyridine-3-boronic acid 95%, 2-Chloro-5-(trifluoromethyl)pyridine-3-boronic Acid, ≥95%, ≥95%, 2-Chloro-5-(trifluoromethyl)pyridine-3-boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
[2-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 536693-96-6) is a chemical compound with the molecular formula C6H4BClF3NO2 and a molecular weight of 225.36 g/mol. IUPAC name: [2-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: OJUNKVOTAZHNAL-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF3NO2 |
|---|---|
| Molecular weight | 225.36 g/mol |
| IUPAC name | [2-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | OJUNKVOTAZHNAL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1Cl)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)