CAS 205240-63-7 appears in our catalog under these names: 2-Chloro-6-trifluoromethylpyridine-3-boronic acid, 96%, 2–Chloro–6–(trifluoromethyl)pyridine–3–boronic Acid, 2-Chloro-6-trifluoromethylpyridine-3-boronic acid, 98%, 98%, (2-Chloro-6-(trifluoromethyl)pyridin-3-yl)boronic acid, 95%, (2-Chloro-6-(trifluoromethyl)pyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 205240-63-7) is a chemical compound with the molecular formula C6H4BClF3NO2 and a molecular weight of 225.36 g/mol. IUPAC name: [2-chloro-6-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: MFBLIMAUCMIBMM-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF3NO2 |
|---|---|
| Molecular weight | 225.36 g/mol |
| IUPAC name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | MFBLIMAUCMIBMM-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)