CAS 2225174-70-7 appears in our catalog under these names: [5-Chloro-2-(trifluoromethyl)pyridin-4-yl]boronic acid, 95%, (5-Chloro-2-(trifluoromethyl)pyridin-4-yl)boronic acid, 95%, (5–CHLORO–2–(TRIFLUOROMETHYL)PYRIDIN–4–YL)BORONIC ACID. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 100mg, 25mg, 5mg.
[5-chloro-2-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 2225174-70-7) is a chemical compound with the molecular formula C6H4BClF3NO2 and a molecular weight of 225.36 g/mol. IUPAC name: [5-chloro-2-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: KCJYCOMFYYZLDU-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF3NO2 |
|---|---|
| Molecular weight | 225.36 g/mol |
| IUPAC name | [5-chloro-2-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | KCJYCOMFYYZLDU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1Cl)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)