cas: 1909306-24-6 — see every product listed under this CAS number, including other names
(6-Methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine dihydrochloride, 98% (CAS 1909306-24-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F553091-100MG |
| cas | 1909306-24-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 1g | 1289.15 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine;dihydrochloride (CAS 1909306-24-6) is a chemical compound with the molecular formula C8H12Cl2N4 and a molecular weight of 235.11 g/mol. IUPAC name: (6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine;dihydrochloride. InChIKey: PJKQLVFLJIHHEB-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N4 |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | (6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine;dihydrochloride |
| InChIKey | PJKQLVFLJIHHEB-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NN=C2CN)C=C1.Cl.Cl |
Computed by PubChem (NCBI)