CAS 267413-33-2 appears in our catalog under these names: 6-(Aminomethyl)-1H-indazol-3-amine dihydrochloride, 98%, 6-(aminomethyl)-1H-indazol-3-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g, 50mg.
6-(aminomethyl)-1H-indazol-3-amine;dihydrochloride (CAS 267413-33-2) is a chemical compound with the molecular formula C8H12Cl2N4 and a molecular weight of 235.11 g/mol. IUPAC name: 6-(aminomethyl)-1H-indazol-3-amine;dihydrochloride. InChIKey: AMNZYLDSFZHYHW-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N4 |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 6-(aminomethyl)-1H-indazol-3-amine;dihydrochloride |
| InChIKey | AMNZYLDSFZHYHW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN)NN=C2N.Cl.Cl |
Computed by PubChem (NCBI)