CAS 14401-56-0 appears in our catalog under these names: p-Phthalamidine Dihydrochloride, >95% (HPLC), Terephthalimidamide dihydrochloride, 1,4-(Diamidino)benzene dihydrochloride, Terephthalimidamide dihydrochloride 97%, 1,4-Terephthalamidine dihydrochloride, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 500mg, 5g, 1g, 2,5g, 100mg, 250mg, 25g.
Benzene-1,4-dicarboximidamide;dihydrochloride (CAS 14401-56-0) is a chemical compound with the molecular formula C8H12Cl2N4 and a molecular weight of 235.11 g/mol. IUPAC name: benzene-1,4-dicarboximidamide;dihydrochloride. InChIKey: XFIJMILWUMIXPQ-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N4 |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | benzene-1,4-dicarboximidamide;dihydrochloride |
| InChIKey | XFIJMILWUMIXPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=N)N)C(=N)N.Cl.Cl |
Computed by PubChem (NCBI)