CAS 73857-55-3 appears in our catalog under these names: 5-Hydrazinyl-2-methyl-1H-benzo(d)imidazole dihydrochloride, 98%, 5-Hydrazinyl-2-methyl-1H-1,3-benzodiazole dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(2-methyl-3H-benzimidazol-5-yl)hydrazine;dihydrochloride (CAS 73857-55-3) is a chemical compound with the molecular formula C8H12Cl2N4 and a molecular weight of 235.11 g/mol. IUPAC name: (2-methyl-3H-benzimidazol-5-yl)hydrazine;dihydrochloride. InChIKey: HMHYUTTXLXOWFV-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N4 |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | (2-methyl-3H-benzimidazol-5-yl)hydrazine;dihydrochloride |
| InChIKey | HMHYUTTXLXOWFV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)NN.Cl.Cl |
Computed by PubChem (NCBI)