(6S,7S)-6,7-Dimethyl-6,7-dihydro-[1,4]dioxocino[6,5-b:7,8-b']dipyridine, 99%
cas: 175411-93-5 — see every product listed under this CAS number, including other names
(6S,7S)-6,7-Dimethyl-6,7-dihydro-[1,4]dioxocino[6,5-b:7,8-b']dipyridine, 99% (CAS 175411-93-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1180276-250mg |
| cas | 175411-93-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2256.06 Pln | |
| Ambeed | 1g | 5910.62 Pln | |
| Chemat | 50mg | 563.60 Pln | |
| Chemat | 100mg | 866.00 Pln | |
| Chemat | 250mg | 1427.60 Pln | |
| Chemat | 1g | 2704.40 Pln | |
| BLDpharm | 50mg | 969.68 Pln | |
| BLDpharm | 100mg | 1497.28 Pln | |
| BLDpharm | 250mg | 2424.73 Pln | |
| BLDpharm | 1g | 6367.78 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
(9S,10S)-9,10-dimethyl-8,11-dioxa-3,16-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaene (CAS 175411-93-5) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: (9S,10S)-9,10-dimethyl-8,11-dioxa-3,16-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaene. InChIKey: AYOIRZGVWHHWMP-UWVGGRQHSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | (9S,10S)-9,10-dimethyl-8,11-dioxa-3,16-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,13,15-hexaene |
| InChIKey | AYOIRZGVWHHWMP-UWVGGRQHSA-N |
| SMILES | C[C@H]1[C@@H](OC2=C(C3=C(O1)C=CC=N3)N=CC=C2)C |
Computed by PubChem (NCBI)
Synonyms:
(Rax,S,S)-C2-ACBP, (Ra,S,S)-C2-ACBP, 99%, ee: 99%